CAS No: 502-61-4, Chemical Name: 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
the physical and chemical property of 502-61-4, 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- is provided by ChemNet.com
ChemNet > CAS > 502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
| نام محصول |
1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- |
| مترادف |
n-Decyl acrylate; 3,7,11-trimethyldodeca-1,3,6,10-tetraene; (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
| میدان مغناطیسی |
C15H24 |
| وزن مولکولی |
204.3511 |
| InChI |
InChI=1/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10+,15-12+ |
| شماره سیایاس |
502-61-4 |
| تعداد کمیسیون اروپایی |
207-948-6 |
| ساختار مولکولی |
|
| تراکم |
0.812g/cm3 |
| نقطه غلیان |
279.6°C at 760 mmHg |
| ضریب شکست |
1.476 |
| نقطه اشتعال |
113.2°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
