ChemNet > CAS > 504-40-5;1323-83-7 1,3-distearin (C18:0)
504-40-5;1323-83-7 1,3-distearin (C18:0)
نام محصول |
1,3-distearin (C18:0) |
مترادف |
1,3-Dioctadecanoylglycerol; 1,3-Di-O-stearoylglycerol; 1,3-Distearin glyceride; 1,3-Distearoylglycerin; Glycerin 1,3-distearate; Glyceryl 1,3-distearate; NSC 404229; Stearic acid diglycerin ester; 2-Hydroxypropane-1,3-diyl distearate; Octadecanoic acid, 2-hydroxy-1,3-propanediyl ester; Stearin, 1,3-di-; distearin (C18:0); Glyceryl distearate; Octadecanoic acid, diester with 1,2,3-propanetriol; AI3-03511; UNII-73071MW2KM; Distearic acid, diester with glycerol; 2-hydroxypropane-1,3-diyl dioctadecanoate; 3-hydroxypropane-1,2-diyl dioctadecanoate |
میدان مغناطیسی |
C39H76O5 |
وزن مولکولی |
625.02 |
InChI |
InChI=1/C39H76O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h37,40H,3-36H2,1-2H3 |
شماره سیایاس |
504-40-5;1323-83-7 |
ساختار مولکولی |
|
تراکم |
0.923g/cm3 |
نقطه غلیان |
662.3°C at 760 mmHg |
ضریب شکست |
1.466 |
نقطه اشتعال |
181.8°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|