ChemNet > CAS > 52729-03-0 2,4-Dichloro-3,5-dinitrobenzoic acid
52729-03-0 2,4-Dichloro-3,5-dinitrobenzoic acid
نام محصول |
2,4-Dichloro-3,5-dinitrobenzoic acid |
مترادف |
2,4-dichloro-3,5-dinitrobenzoate |
میدان مغناطیسی |
C7HCl2N2O6 |
وزن مولکولی |
279.9992 |
InChI |
InChI=1/C7H2Cl2N2O6/c8-4-2(7(12)13)1-3(10(14)15)5(9)6(4)11(16)17/h1H,(H,12,13)/p-1 |
شماره سیایاس |
52729-03-0 |
تعداد کمیسیون اروپایی |
258-136-3 |
ساختار مولکولی |
|
نقطه ذوب |
210-215℃ |
نقطه غلیان |
433.7°C at 760 mmHg |
نقطه اشتعال |
216.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|