CAS No: 5450-56-6, Chemical Name: N,N-Dimethyl-2,(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine
the physical and chemical property of 5450-56-6, N,N-Dimethyl-2,(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine is provided by ChemNet.com
ChemNet > CAS > 5450-56-6 N,N-Dimethyl-2,(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine
5450-56-6 N,N-Dimethyl-2,(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine
نام محصول |
N,N-Dimethyl-2,(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine |
مترادف |
N,N-Dimethyl-2(2-(4-(2,4,4-trimethyl pentan-2-yl)phenoxy)ethoxy)ethanamine;
; N,N-dimethyl-2-[2-(4-octylphenoxy)ethoxy]ethanamine |
میدان مغناطیسی |
C20H35NO2 |
وزن مولکولی |
321.4974 |
InChI |
InChI=1/C20H35NO2/c1-4-5-6-7-8-9-10-19-11-13-20(14-12-19)23-18-17-22-16-15-21(2)3/h11-14H,4-10,15-18H2,1-3H3 |
شماره سیایاس |
5450-56-6 |
ساختار مولکولی |
|
تراکم |
0.941g/cm3 |
نقطه غلیان |
418.7°C at 760 mmHg |
ضریب شکست |
1.491 |
نقطه اشتعال |
113.1°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|