ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
نام محصول |
p-Diethylaminoacetophenone |
مترادف |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
میدان مغناطیسی |
C12H17NO |
وزن مولکولی |
191.2695 |
InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
شماره سیایاس |
5520-66-1 |
ساختار مولکولی |
|
تراکم |
0.996g/cm3 |
نقطه غلیان |
313.9°C at 760 mmHg |
ضریب شکست |
1.536 |
نقطه اشتعال |
114.4°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|