ChemNet > CAS > 5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
نام محصول |
D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1) |
مترادف |
Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
میدان مغناطیسی |
C6H11BO8 |
وزن مولکولی |
221.9577 |
InChI |
InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
شماره سیایاس |
5743-34-0 |
تعداد کمیسیون اروپایی |
227-264-1 |
ساختار مولکولی |
|
تراکم |
1.68g/cm3 |
نقطه غلیان |
530.9°C at 760 mmHg |
ضریب شکست |
1.558 |
نقطه اشتعال |
274.9°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|