ChemNet > CAS > 622-20-8 1,2-Bis(phenylthio)ethane
622-20-8 1,2-Bis(phenylthio)ethane
نام محصول |
1,2-Bis(phenylthio)ethane |
مترادف |
1,2-Bis(phenylthio)ethane,98%; 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
میدان مغناطیسی |
C14H14S2 |
وزن مولکولی |
246.391 |
InChI |
InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
شماره سیایاس |
622-20-8 |
تعداد کمیسیون اروپایی |
210-723-5 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه غلیان |
377.3°C at 760 mmHg |
ضریب شکست |
1.646 |
نقطه اشتعال |
184.6°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|