ChemNet > CAS > 623-82-5 (+)-3-Methyladipic acid
623-82-5 (+)-3-Methyladipic acid
نام محصول |
(+)-3-Methyladipic acid |
مترادف |
Methylhexanedioic acid; (3R)-3-methylhexanedioic acid; (3R)-3-methylhexanedioate |
میدان مغناطیسی |
C7H10O4 |
وزن مولکولی |
158.153 |
InChI |
InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m1/s1 |
شماره سیایاس |
623-82-5 |
تعداد کمیسیون اروپایی |
210-816-0 |
ساختار مولکولی |
|
نقطه ذوب |
81-84℃ |
نقطه غلیان |
341.4°C at 760 mmHg |
نقطه اشتعال |
170.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|