ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
| نام محصول |
4,5-Dibromothiophene-2-carboxylic acid |
| مترادف |
4,5-Dibromothenoic acid |
| میدان مغناطیسی |
C5H2Br2O2S |
| وزن مولکولی |
285.9412 |
| InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
| شماره سیایاس |
6324-10-3 |
| تعداد کمیسیون اروپایی |
228-683-2 |
| ساختار مولکولی |
|
| تراکم |
2.309g/cm3 |
| نقطه غلیان |
367.1°C at 760 mmHg |
| ضریب شکست |
1.682 |
| نقطه اشتعال |
175.8°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
