ChemNet > CAS > 6324-11-4 (2-hydroxyphenoxy)acetic acid
6324-11-4 (2-hydroxyphenoxy)acetic acid
| نام محصول |
(2-hydroxyphenoxy)acetic acid |
| مترادف |
2-Hydroxyphenoxyacetic acid |
| میدان مغناطیسی |
C8H8O4 |
| وزن مولکولی |
168.1467 |
| InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| شماره سیایاس |
6324-11-4 |
| تعداد کمیسیون اروپایی |
228-684-8 |
| ساختار مولکولی |
|
| تراکم |
1.367g/cm3 |
| نقطه ذوب |
138-141℃ |
| نقطه غلیان |
339.6°C at 760 mmHg |
| ضریب شکست |
1.581 |
| نقطه اشتعال |
143°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
