ChemNet > CAS > 716-53-0 9-chloroanthracene
716-53-0 9-chloroanthracene
| نام محصول |
9-chloroanthracene |
| مترادف |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
| میدان مغناطیسی |
C14H9Cl |
| وزن مولکولی |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| شماره سیایاس |
716-53-0 |
| تعداد کمیسیون اروپایی |
211-937-1 |
| ساختار مولکولی |
|
| تراکم |
1.253g/cm3 |
| نقطه ذوب |
103-103℃ |
| نقطه غلیان |
370.1°C at 760 mmHg |
| ضریب شکست |
1.717 |
| نقطه اشتعال |
179.2°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
