ChemNet > CAS > 7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
| نام محصول |
Triethyl 1,1,2-ethanetricarboxylate |
| مترادف |
1,1,2-Ethanetricarboxylic acid triethyl ester; Triethyl ethane-1,1,2-tricarboxylate; 1,1,2-Ethanetricarboxylic acid, 1,1,2-triethyl ester;
|
| میدان مغناطیسی |
C11H18O6 |
| وزن مولکولی |
246.257 |
| InChI |
InChI=1/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
| شماره سیایاس |
7459-46-3 |
| تعداد کمیسیون اروپایی |
231-235-9 |
| ساختار مولکولی |
|
| تراکم |
1.114g/cm3 |
| نقطه غلیان |
300.7°C at 760 mmHg |
| ضریب شکست |
1.44 |
| نقطه اشتعال |
127.4°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
