ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
نام محصول |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
میدان مغناطیسی |
C9H7NO2S |
وزن مولکولی |
193.2224 |
InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
شماره سیایاس |
74772-17-1 |
ساختار مولکولی |
|
تراکم |
1.37g/cm3 |
نقطه ذوب |
174℃ |
نقطه غلیان |
377.3°C at 760 mmHg |
ضریب شکست |
1.669 |
نقطه اشتعال |
182°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|