ChemNet > CAS > 7605-25-6 Ethyl (phenylthio)acetate
7605-25-6 Ethyl (phenylthio)acetate
| نام محصول |
Ethyl (phenylthio)acetate |
| مترادف |
Ethyl 2-(phenylthio)acetate; ethyl (phenylsulfanyl)acetate; 2-(phenylsulfanyl)butanoic acid |
| میدان مغناطیسی |
C10H12O2S |
| وزن مولکولی |
196.2661 |
| InChI |
InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| شماره سیایاس |
7605-25-6 |
| ساختار مولکولی |
|
| تراکم |
1.18g/cm3 |
| نقطه غلیان |
330.3°C at 760 mmHg |
| ضریب شکست |
1.579 |
| نقطه اشتعال |
153.5°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
