ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
نام محصول |
Diallyl maleate |
مترادف |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
میدان مغناطیسی |
C10H12O4 |
وزن مولکولی |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
شماره سیایاس |
999-21-3 |
تعداد کمیسیون اروپایی |
213-658-0 |
ساختار مولکولی |
|
تراکم |
1.064g/cm3 |
نقطه غلیان |
263.7°C at 760 mmHg |
ضریب شکست |
1.469 |
نقطه اشتعال |
124.6°C |
خطر نمادها |
|
کدهای خطر |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|