ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
| Nome del prodotto |
ethyl (R)-(-)-mandelate |
| Sinonimi |
(-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| Formula molecolare |
C10H12O3 |
| Peso Molecolare |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| Numero CAS |
10606-72-1 |
| Struttura molecolare |
|
| Densità |
1.147g/cm3 |
| Punto di fusione |
33-34℃ |
| Punto di ebollizione |
254°C at 760 mmHg |
| Indice di rifrazione |
1.528 |
| Punto d'infiammabilità |
118.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
