ChemNet > CAS > 108847-76-3 Thianthrene-1-boronic acid
108847-76-3 Thianthrene-1-boronic acid
| Nome del prodotto |
Thianthrene-1-boronic acid |
| Sinonimi |
1-Thianthrenylboronic acid; thianthren-1-ylboronic acid |
| Formula molecolare |
C12H9BO2S2 |
| Peso Molecolare |
260.1397 |
| InChI |
InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H |
| Numero CAS |
108847-76-3 |
| Struttura molecolare |
|
| Densità |
1.48g/cm3 |
| Punto di fusione |
146-149℃ |
| Punto di ebollizione |
472.7°C at 760 mmHg |
| Indice di rifrazione |
1.756 |
| Punto d'infiammabilità |
239.7°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
