ChemNet > CAS > 1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
| Nome del prodotto |
(2-Carboxyphenyl)iminodiacetic acid |
| Sinonimi |
N,N-Bis(carboxymethyl)anthranilic acid; 2-[bis(carboxymethyl)amino]benzoic acid |
| Formula molecolare |
C11H11NO6 |
| Peso Molecolare |
253.2081 |
| InChI |
InChI=1/C11H11NO6/c13-9(14)5-12(6-10(15)16)8-4-2-1-3-7(8)11(17)18/h1-4H,5-6H2,(H,13,14)(H,15,16)(H,17,18) |
| Numero CAS |
1147-65-5 |
| Struttura molecolare |
|
| Densità |
1.56g/cm3 |
| Punto di ebollizione |
560.9°C at 760 mmHg |
| Indice di rifrazione |
1.66 |
| Punto d'infiammabilità |
293°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
