ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
| Nome del prodotto |
2,4-dimethylquinoline |
| Sinonimi |
Dimethylquinoline |
| Formula molecolare |
C11H11N |
| Peso Molecolare |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| Numero CAS |
1198-37-4 |
| EINECS |
214-832-9 |
| Struttura molecolare |
|
| Densità |
1.052g/cm3 |
| Punto di ebollizione |
263.8°C at 760 mmHg |
| Indice di rifrazione |
1.61 |
| Punto d'infiammabilità |
107.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
