ChemNet > CAS > 21055-37-8 Methyl 2-isothiocyanatoacetate
21055-37-8 Methyl 2-isothiocyanatoacetate
| Nome del prodotto |
Methyl 2-isothiocyanatoacetate |
| Sinonimi |
2-Isothiocyanatoacetic acid methyl ester; thyl 2-isothiocyanatoacetate; methyl N-(thioxomethylidene)glycinate |
| Formula molecolare |
C4H5NO2S |
| Peso Molecolare |
131.153 |
| InChI |
InChI=1/C4H5NO2S/c1-7-4(6)2-5-3-8/h2H2,1H3 |
| Numero CAS |
21055-37-8 |
| Struttura molecolare |
|
| Densità |
1.16g/cm3 |
| Punto di ebollizione |
193.9°C at 760 mmHg |
| Indice di rifrazione |
1.503 |
| Punto d'infiammabilità |
71.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
