ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
| Nome del prodotto |
2,3-Difluoro-4-methylbenzoic acid |
| Sinonimi |
2,3-Difluoro-p-toluic acid |
| Formula molecolare |
C8H6F2O2 |
| Peso Molecolare |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
| Numero CAS |
261763-37-5 |
| Struttura molecolare |
|
| Densità |
1.359g/cm3 |
| Punto di ebollizione |
274°C at 760 mmHg |
| Indice di rifrazione |
1.511 |
| Punto d'infiammabilità |
119.5°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
