ChemNet > CAS > 3088-42-4 N-(2-Cyanoethyl)glycine
3088-42-4 N-(2-Cyanoethyl)glycine
| Nome del prodotto |
N-(2-Cyanoethyl)glycine |
| Sinonimi |
N-(2-Cyanoehtyl)glycine |
| Formula molecolare |
C5H8N2O2 |
| Peso Molecolare |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| Numero CAS |
3088-42-4 |
| EINECS |
221-418-1 |
| Struttura molecolare |
|
| Densità |
1.187g/cm3 |
| Punto di fusione |
188-193℃ |
| Punto di ebollizione |
343.1°C at 760 mmHg |
| Indice di rifrazione |
1.473 |
| Punto d'infiammabilità |
161.3°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
