ChemNet > CAS > 332-51-4 (4-fluorophenylthio)acetic acid
332-51-4 (4-fluorophenylthio)acetic acid
| Nome del prodotto |
(4-fluorophenylthio)acetic acid |
| Sinonimi |
2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
| Formula molecolare |
C8H6FO2S |
| Peso Molecolare |
185.196 |
| InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Numero CAS |
332-51-4 |
| Struttura molecolare |
|
| Punto di fusione |
76-79℃ |
| Punto di ebollizione |
315.4°C at 760 mmHg |
| Punto d'infiammabilità |
144.5°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
