ChemNet > CAS > 3529-82-6 3-nitrophenyl isothiocyanate
3529-82-6 3-nitrophenyl isothiocyanate
| Nome del prodotto |
3-nitrophenyl isothiocyanate |
| Sinonimi |
3-Isothiocyanatonitrobenzene; 1-isothiocyanato-3-nitrobenzene |
| Formula molecolare |
C7H4N2O2S |
| Peso Molecolare |
180.1839 |
| InChI |
InChI=1/C7H4N2O2S/c10-9(11)7-3-1-2-6(4-7)8-5-12/h1-4H |
| Numero CAS |
3529-82-6 |
| Struttura molecolare |
|
| Densità |
1.33g/cm3 |
| Punto di fusione |
57-60℃ |
| Punto di ebollizione |
317.8°C at 760 mmHg |
| Indice di rifrazione |
1.631 |
| Punto d'infiammabilità |
146°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
