ChemNet > CAS > 36919-03-6 Methyl pentafluorophenyl carbonate
36919-03-6 Methyl pentafluorophenyl carbonate
| Nome del prodotto |
Methyl pentafluorophenyl carbonate |
| Sinonimi |
Pentafluorophenyl methyl carbonate |
| Formula molecolare |
C8H3F5O3 |
| Peso Molecolare |
242.0996 |
| InChI |
InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| Numero CAS |
36919-03-6 |
| Struttura molecolare |
|
| Densità |
1.567g/cm3 |
| Punto di ebollizione |
207.5°C at 760 mmHg |
| Indice di rifrazione |
1.422 |
| Punto d'infiammabilità |
77.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
