ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
| Nome del prodotto |
4-Bromo-3-methylbenzonitrile |
| Sinonimi |
4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
| Formula molecolare |
C8H6BrN |
| Peso Molecolare |
196.0439 |
| InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| Numero CAS |
41963-20-6 |
| Struttura molecolare |
|
| Densità |
1.51g/cm3 |
| Punto di ebollizione |
265°C at 760 mmHg |
| Indice di rifrazione |
1.59 |
| Punto d'infiammabilità |
114.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
