ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| Nome del prodotto |
2-aminothiophene-3-carbonitrile |
| Sinonimi |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| Formula molecolare |
C5H4N2S |
| Peso Molecolare |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| Numero CAS |
4651-82-5 |
| Struttura molecolare |
|
| Densità |
1.33g/cm3 |
| Punto di fusione |
104℃ |
| Punto di ebollizione |
317.5°C at 760 mmHg |
| Indice di rifrazione |
1.627 |
| Punto d'infiammabilità |
145.8°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
