ChemNet > CAS > 576-82-9 5-fluoro-1,2,3-tribromobenzene
576-82-9 5-fluoro-1,2,3-tribromobenzene
| Nome del prodotto |
5-fluoro-1,2,3-tribromobenzene |
| Sinonimi |
; 1,2,3-tricromo-5-fluorobenzene |
| Nome inglese |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
| Formula molecolare |
C6H2Br3F |
| Peso Molecolare |
332.7905 |
| InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
| Numero CAS |
576-82-9 |
| Struttura molecolare |
|
| Densità |
2.34g/cm3 |
| Punto di ebollizione |
274.2°C at 760 mmHg |
| Indice di rifrazione |
1.61 |
| Punto d'infiammabilità |
119.6°C |
| Pressione di vapore |
0.0092mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|