ChemNet > CAS > 57915-78-3 2,3-dichlorobenzyl bromide
57915-78-3 2,3-dichlorobenzyl bromide
| Nome del prodotto |
2,3-dichlorobenzyl bromide |
| Sinonimi |
1-(bromomethyl)-2,3-dichlorobenzene |
| Formula molecolare |
C7H5BrCl2 |
| Peso Molecolare |
239.9246 |
| InChI |
InChI=1/C7H5BrCl2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
| Numero CAS |
57915-78-3 |
| Struttura molecolare |
|
| Densità |
1.679g/cm3 |
| Punto di fusione |
38℃ |
| Punto di ebollizione |
263.3°C at 760 mmHg |
| Indice di rifrazione |
1.597 |
| Punto d'infiammabilità |
127.3°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
