5949-05-3 L(-)-Citronellale
Nome del prodotto |
L(-)-Citronellale |
Sinonimi |
;(S)-(-)-3,7-dimetil-6-ottenale; (S)-()-Citronellale; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimetilott-6-enale; (-)-Citronellale |
Nome inglese |
L(-)-Citronellal; (S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
Formula molecolare |
C10H18O |
Peso Molecolare |
154.2493 |
InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
Numero CAS |
5949-05-3 |
EINECS |
227-707-9 |
Struttura molecolare |
|
Densità |
0.835g/cm3 |
Punto di ebollizione |
208.4°C at 760 mmHg |
Indice di rifrazione |
1.437 |
Punto d'infiammabilità |
75.6°C |
Pressione di vapore |
0.215mmHg at 25°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|