ChemNet > CAS > 6095-82-5 2,4,6-Trimethylphenyl isothiocyanate
6095-82-5 2,4,6-Trimethylphenyl isothiocyanate
| Nome del prodotto |
2,4,6-Trimethylphenyl isothiocyanate |
| Sinonimi |
Mesityl isothiocyanate; 2-isothiocyanato-1,3,5-trimethylbenzene |
| Formula molecolare |
C10H11NS |
| Peso Molecolare |
177.266 |
| InChI |
InChI=1/C10H11NS/c1-7-4-8(2)10(11-6-12)9(3)5-7/h4-5H,1-3H3 |
| Numero CAS |
6095-82-5 |
| Struttura molecolare |
|
| Densità |
1g/cm3 |
| Punto di ebollizione |
286.3°C at 760 mmHg |
| Indice di rifrazione |
1.549 |
| Punto d'infiammabilità |
130.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
