ChemNet > CAS > 760-23-6 3,4-Dichloro-1-butene
760-23-6 3,4-Dichloro-1-butene
| Nome del prodotto |
3,4-Dichloro-1-butene |
| Sinonimi |
Dichlorobutene; 3,4-Dichlorobutene-1; 3,4-dichlorobut-1-ene |
| Formula molecolare |
C4H6Cl2 |
| Peso Molecolare |
124.9964 |
| InChI |
InChI=1/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
| Numero CAS |
760-23-6 |
| EINECS |
212-079-0 |
| Struttura molecolare |
|
| Densità |
1.108g/cm3 |
| Punto di fusione |
-61℃ |
| Punto di ebollizione |
116°C at 760 mmHg |
| Indice di rifrazione |
1.443 |
| Punto d'infiammabilità |
28.3°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
