ChemNet > CAS > 7605-25-6 Ethyl (phenylthio)acetate
7605-25-6 Ethyl (phenylthio)acetate
| Nome del prodotto |
Ethyl (phenylthio)acetate |
| Sinonimi |
Ethyl 2-(phenylthio)acetate; ethyl (phenylsulfanyl)acetate; 2-(phenylsulfanyl)butanoic acid |
| Formula molecolare |
C10H12O2S |
| Peso Molecolare |
196.2661 |
| InChI |
InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| Numero CAS |
7605-25-6 |
| Struttura molecolare |
|
| Densità |
1.18g/cm3 |
| Punto di ebollizione |
330.3°C at 760 mmHg |
| Indice di rifrazione |
1.579 |
| Punto d'infiammabilità |
153.5°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
