CAS No: 80450-69-7;2630-39-9;151716-36-8, Chemical Name: Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
the physical and chemical property of 80450-69-7;2630-39-9;151716-36-8, Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- is provided by ChemNet.com
ChemNet > CAS > 80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
| Nome del prodotto |
Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- |
| Sinonimi |
Methyl trans-dihydrojasmonate; (-)-Methyl dihydrojasmonate; Dihydrojasmonic Acid Methyl Ester; METHYLDIHYDROJASMONATE; methyl [(1R,2R)-3-oxo-2-pentylcyclopentyl]acetate; Methyl 2-(3-Oxo-2-Pentylcyclopentyl)Acetate |
| Formula molecolare |
C13H22O3 |
| Peso Molecolare |
226.312 |
| InChI |
InChI=1/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| Numero CAS |
80450-69-7;2630-39-9;151716-36-8 |
| EINECS |
220-112-5 |
| Struttura molecolare |
|
| Densità |
0.984g/cm3 |
| Punto di ebollizione |
307.8°C at 760 mmHg |
| Indice di rifrazione |
1.453 |
| Punto d'infiammabilità |
130.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
