ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
| Nome del prodotto |
p-Tolyl chlorothionoformate |
| Sinonimi |
p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
| Formula molecolare |
C8H7ClOS |
| Peso Molecolare |
186.6586 |
| InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| Numero CAS |
937-63-3 |
| EINECS |
213-333-3 |
| Struttura molecolare |
|
| Densità |
1.277g/cm3 |
| Punto di ebollizione |
244.8°C at 760 mmHg |
| Indice di rifrazione |
1.598 |
| Punto d'infiammabilità |
101.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
