ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
| Nome del prodotto |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
| Formula molecolare |
C7H3F4NO2 |
| Peso Molecolare |
209.0978 |
| InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
| Numero CAS |
944-43-4 |
| EINECS |
213-409-6 |
| Struttura molecolare |
|
| Densità |
1.726g/cm3 |
| Punto di fusione |
185-187℃ |
| Punto di ebollizione |
283.6°C at 760 mmHg |
| Indice di rifrazione |
1.529 |
| Punto d'infiammabilità |
125.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
