ChemNet > CAS > 96424-68-9 2-Bromo-3-chloropyridine
96424-68-9 2-Bromo-3-chloropyridine
| Nome del prodotto |
2-Bromo-3-chloropyridine |
| Formula molecolare |
C5H3BrClN |
| Peso Molecolare |
192.441 |
| InChI |
InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H |
| Numero CAS |
96424-68-9 |
| Struttura molecolare |
|
| Densità |
1.736g/cm3 |
| Punto di ebollizione |
223.9°C at 760 mmHg |
| Indice di rifrazione |
1.581 |
| Punto d'infiammabilità |
89.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
