ChemNet > CAS > 10273-90-2 3-Methyl-2-phenylpyridine
10273-90-2 3-Methyl-2-phenylpyridine
상품명칭 |
3-Methyl-2-phenylpyridine |
별명 |
2-Phenyl-3-picoline |
분자식 |
C12H11N |
분자량 |
169.2224 |
InChI |
InChI=1/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3 |
cas번호 |
10273-90-2 |
EC번호 |
233-619-1 |
분자 구조 |
|
밀도 |
1.03g/cm3 |
비등점 |
278.2°C at 760 mmHg |
굴절 지수 |
1.568 |
인화점 |
96.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|