ChemNet > CAS > 10352-88-2 trans-2-Heptenoic acid
10352-88-2 trans-2-Heptenoic acid
상품명칭 |
trans-2-Heptenoic acid |
별명 |
Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
cas번호 |
10352-88-2 |
EC번호 |
233-769-8 |
분자 구조 |
|
밀도 |
0.968g/cm3 |
비등점 |
226.6°C at 760 mmHg |
굴절 지수 |
1.457 |
인화점 |
133.4°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|