112193-41-6 5-브로모피리딘-3-카보하이드라지드
| 상품명칭 |
5-브로모피리딘-3-카보하이드라지드 |
| 영문 이름 |
5-bromopyridine-3-carbohydrazide; |
| 분자식 |
C6H6BrN3O |
| 분자량 |
216.0353 |
| InChI |
InChI=1/C6H6BrN3O/c7-5-1-4(2-9-3-5)6(11)10-8/h1-3H,8H2,(H,10,11) |
| cas번호 |
112193-41-6 |
| 분자 구조 |
|
| 밀도 |
1.709g/cm3 |
| 녹는 점 |
204℃ |
| 굴절 지수 |
1.623 |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|