ChemNet > CAS > 1123-00-8 Cyclopentylacetic acid
1123-00-8 Cyclopentylacetic acid
상품명칭 |
Cyclopentylacetic acid |
별명 |
Cyclopentaneacetic acid; cycylopentylacetic acid; cyclopentylacetate |
분자식 |
C7H11O2 |
분자량 |
127.1616 |
InChI |
InChI=1/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9)/p-1 |
cas번호 |
1123-00-8 |
EC번호 |
214-368-7 |
분자 구조 |
|
비등점 |
230.2°C at 760 mmHg |
인화점 |
114°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|