ChemNet > CAS > 116493-07-3 4-시아노-3-(4-메톡시페닐)-5-(메틸티오)티오펜-2-카르복실산
116493-07-3 4-시아노-3-(4-메톡시페닐)-5-(메틸티오)티오펜-2-카르복실산
| 상품명칭 |
4-시아노-3-(4-메톡시페닐)-5-(메틸티오)티오펜-2-카르복실산 |
| 별명 |
4-시아노-3-(4-메톡시페닐)-5-(메틸설파닐)티오펜-2-카르복실산 |
| 영문 이름 |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| 분자식 |
C14H11NO3S2 |
| 분자량 |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| cas번호 |
116493-07-3 |
| 분자 구조 |
|
| 밀도 |
1.43g/cm3 |
| 녹는 점 |
209℃ |
| 비등점 |
464.9°C at 760 mmHg |
| 굴절 지수 |
1.67 |
| 인화점 |
234.9°C |
| 증기압 |
1.93E-09mmHg at 25°C |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|