ChemNet > CAS > 127957-83-9 ethyl 2-amino-4-propylpyrimidine-5-carboxylate
127957-83-9 ethyl 2-amino-4-propylpyrimidine-5-carboxylate
상품명칭 |
ethyl 2-amino-4-propylpyrimidine-5-carboxylate |
분자식 |
C10H15N3O2 |
분자량 |
209.245 |
InChI |
InChI=1/C10H15N3O2/c1-3-5-8-7(9(14)15-4-2)6-12-10(11)13-8/h6H,3-5H2,1-2H3,(H2,11,12,13) |
cas번호 |
127957-83-9 |
분자 구조 |
|
밀도 |
1.15g/cm3 |
녹는 점 |
127℃ |
비등점 |
396.9°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
193.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|