ChemNet > CAS > 13026-12-5 3-(1-Naphthyl)acrylic acid
13026-12-5 3-(1-Naphthyl)acrylic acid
상품명칭 |
3-(1-Naphthyl)acrylic acid |
별명 |
(2E)-3-(naphthalen-1-yl)prop-2-enoic acid; (2E)-3-naphthalen-1-ylprop-2-enal; (2E)-3-naphthalen-1-ylprop-2-enoate; 1-Naphthylacrylic acid |
분자식 |
C13H9O2 |
분자량 |
197.2099 |
InChI |
InChI=1/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/p-1/b9-8+ |
cas번호 |
13026-12-5 |
EC번호 |
235-887-5 |
분자 구조 |
|
비등점 |
393.1°C at 760 mmHg |
인화점 |
290.7°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|