13321-74-9 1-브로모-2,5-디메톡시-4-메틸벤젠
| 상품명칭 |
1-브로모-2,5-디메톡시-4-메틸벤젠 |
| 영문 이름 |
1-bromo-2,5-dimethoxy-4-methylbenzene; |
| 분자식 |
C9H11BrO2 |
| 분자량 |
231.0864 |
| InChI |
InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| cas번호 |
13321-74-9 |
| 분자 구조 |
|
| 밀도 |
1.36g/cm3 |
| 녹는 점 |
77℃ |
| 비등점 |
270.4°C at 760 mmHg |
| 굴절 지수 |
1.525 |
| 인화점 |
114.1°C |
| 증기압 |
0.0114mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|