ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
상품명칭 |
3,5-Dimethoxyphenylacetonitrile |
분자식 |
C10H11NO2 |
분자량 |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
cas번호 |
13388-75-5 |
EC번호 |
202-225-1 |
분자 구조 |
|
밀도 |
1.082g/cm3 |
비등점 |
316.7°C at 760 mmHg |
굴절 지수 |
1.511 |
인화점 |
127.3°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|