ChemNet > CAS > 1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
상품명칭 |
2,4-Dichloro-Alpha-methylbenzyl alcohol |
별명 |
Benzyl alcohol, 2,4-dichloro-alpha-methyl-; 1-(2,4-dichlorophenyl)ethanol; (1S)-1-(2,4-dichlorophenyl)ethanol; (1R)-1-(2,4-dichlorophenyl)ethanol; 2,4-Dichloro-a-methylbenzyl alcohol |
분자식 |
C8H8Cl2O |
분자량 |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5,11H,1H3/t5-/m1/s1 |
cas번호 |
1475-13-4 |
EC번호 |
216-019-4 |
분자 구조 |
|
밀도 |
1.323g/cm3 |
비등점 |
270.7°C at 760 mmHg |
굴절 지수 |
1.566 |
인화점 |
115.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|