ChemNet > CAS > 15585-71-4 Brometenamine
15585-71-4 Brometenamine
| 상품명칭 |
Brometenamine |
| 별명 |
Brometenamine [INN:DCF]; 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with tribromomethane (1:1); Brometenamina; Brometenaminum; Equimolecular complex of bromoform and hexamethylenetetramine; Hexamethylenetetramine, compd. with tribromomethane (1:1); UNII-VW6613KQ0H; 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane - tribromomethane (1:1) |
| 분자식 |
C7H13Br3N4 |
| 분자량 |
392.9169 |
| InChI |
InChI=1/C6H12N4.CHBr3/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1(3)4/h1-6H2;1H |
| cas번호 |
15585-71-4 |
| 분자 구조 |
|
| 비등점 |
252.7°C at 760 mmHg |
| 인화점 |
103.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
