ChemNet > CAS > 157373-00-7 3-Chloro-2,4-difluorobenzoyl chloride
157373-00-7 3-Chloro-2,4-difluorobenzoyl chloride
상품명칭 |
3-Chloro-2,4-difluorobenzoyl chloride |
분자식 |
C7H2Cl2F2O |
분자량 |
210.993 |
InChI |
InChI=1/C7H2Cl2F2O/c8-5-4(10)2-1-3(6(5)11)7(9)12/h1-2H |
cas번호 |
157373-00-7 |
분자 구조 |
|
밀도 |
1.548g/cm3 |
비등점 |
206.9°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
78.9°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|