ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
상품명칭 |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
별명 |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
분자식 |
C6H2BF5O2 |
분자량 |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
cas번호 |
1582-24-7 |
분자 구조 |
|
밀도 |
1.61g/cm3 |
비등점 |
244°C at 760 mmHg |
굴절 지수 |
1.429 |
인화점 |
101.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|